About methyl 2-methylprop-2-enoate;pyrrolidin-2-one
methyl 2-methylprop-2-enoate;pyrrolidin-2-one (PubChem CID 19702429) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;pyrrolidin-2-one.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;pyrrolidin-2-one |
| PubChem CID | 19702429 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl 2-methylprop-2-enoate;pyrrolidin-2-one |
| SMILES | C=C(C)C(=O)OC.O=C1CCCN1 |
| InChI | InChI=1S/C5H8O2.C4H7NO/c1-4(2)5(6)7-3;6-4-2-1-3-5-4/h1H2,2-3H3;1-3H2,(H,5,6) |
| InChIKey | MCNMNAQLEGOPEF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The IUPAC name of methyl 2-methylprop-2-enoate;pyrrolidin-2-one (CID 19702429) is methyl 2-methylprop-2-enoate;pyrrolidin-2-one.
What is the SMILES notation for methyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The canonical SMILES for methyl 2-methylprop-2-enoate;pyrrolidin-2-one is C=C(C)C(=O)OC.O=C1CCCN1.
What is the InChIKey of methyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The InChIKey is MCNMNAQLEGOPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H7NO/c1-4(2)5(6)7-3;6-4-2-1-3-5-4/h1H2,2-3H3;1-3H2,(H,5,6).
What are the key properties of methyl 2-methylprop-2-enoate;pyrrolidin-2-one?
methyl 2-methylprop-2-enoate;pyrrolidin-2-one has a molecular weight of 185.22 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;pyrrolidin-2-one is sourced from PubChem (CID 19702429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).