C16H20N4OS — CID 19703316
1-(1H-benzimidazol-2-ylsulfanyl)-3-[2-(cyclohexen-1-yl)ethyl]urea (PubChem CID 19703316) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-ylsulfanyl)-3-[2-(cyclohexen-1-yl)ethyl]urea.
| Compound Name | 1-(1H-benzimidazol-2-ylsulfanyl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 19703316 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(1H-benzimidazol-2-ylsulfanyl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
| SMILES | O=C(NCCC1=CCCCC1)NSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H20N4OS/c21-15(17-11-10-12-6-2-1-3-7-12)20-22-16-18-13-8-4-5-9-14(13)19-16/h4-6,8-9H,1-3,7,10-11H2,(H,18,19)(H2,17,20,21) |
| InChIKey | XUBWWKNMDVNBRB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|