C6H9F2NO2 — CID 19704267
2-(4,4-difluorobut-3-enylamino)acetic acid (PubChem CID 19704267) has the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylamino)acetic acid.
| Compound Name | 2-(4,4-difluorobut-3-enylamino)acetic acid |
|---|---|
| PubChem CID | 19704267 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylamino)acetic acid |
| SMILES | O=C(O)CNCCC=C(F)F |
| InChI | InChI=1S/C6H9F2NO2/c7-5(8)2-1-3-9-4-6(10)11/h2,9H,1,3-4H2,(H,10,11) |
| InChIKey | JDUOVFFJIYQWRD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|