C12H19N2O8+ — CID 87763774
tris(carboxymethyl)-[(E)-4-(carboxymethylamino)but-1-enyl]azanium (PubChem CID 87763774) has the molecular formula C12H19N2O8+ and a molecular weight of 319.29 g/mol. Its IUPAC name is tris(carboxymethyl)-[(E)-4-(carboxymethylamino)but-1-enyl]azanium.
| Compound Name | tris(carboxymethyl)-[(E)-4-(carboxymethylamino)but-1-enyl]azanium |
|---|---|
| PubChem CID | 87763774 |
| Molecular Formula | C12H19N2O8+ |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | tris(carboxymethyl)-[(E)-4-(carboxymethylamino)but-1-enyl]azanium |
| SMILES | O=C(O)CNCC/C=C/[N+](CC(=O)O)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C12H18N2O8/c15-9(16)5-13-3-1-2-4-14(6-10(17)18,7-11(19)20)8-12(21)22/h2,4,13H,1,3,5-8H2,(H3-,15,16,17,18,19,20,21,22)/p+1/b4-2+ |
| InChIKey | XEXNTZPUQSLCHE-DUXPYHPUSA-O |
| XLogP | -1.37 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|