C21H24Br2NO- — CID 19705341
2-bromo-1-(1,4-dibenzylpiperidin-4-yl)ethanone bromide (PubChem CID 19705341) has the molecular formula C21H24Br2NO- and a molecular weight of 466.24 g/mol. Its IUPAC name is 2-bromo-1-(1,4-dibenzylpiperidin-4-yl)ethanone bromide.
| Compound Name | 2-bromo-1-(1,4-dibenzylpiperidin-4-yl)ethanone bromide |
|---|---|
| PubChem CID | 19705341 |
| Molecular Formula | C21H24Br2NO- |
| Molecular Weight | 466.24 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 2-bromo-1-(1,4-dibenzylpiperidin-4-yl)ethanone bromide |
| SMILES | O=C(CBr)C1(Cc2ccccc2)CCN(Cc2ccccc2)CC1.[Br-] |
| InChI | InChI=1S/C21H24BrNO.BrH/c22-16-20(24)21(15-18-7-3-1-4-8-18)11-13-23(14-12-21)17-19-9-5-2-6-10-19;/h1-10H,11-17H2;1H/p-1 |
| InChIKey | XDOYERKQUMLTIW-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|