C28H32N2O3 — CID 71726690
1,3-dibenzyl-N-[(3,5-dimethoxyphenyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 71726690) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1,3-dibenzyl-N-[(3,5-dimethoxyphenyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | 1,3-dibenzyl-N-[(3,5-dimethoxyphenyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71726690 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 1,3-dibenzyl-N-[(3,5-dimethoxyphenyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | COc1cc(CNC(=O)C2(Cc3ccccc3)CCN(Cc3ccccc3)C2)cc(OC)c1 |
| InChI | InChI=1S/C28H32N2O3/c1-32-25-15-24(16-26(17-25)33-2)19-29-27(31)28(18-22-9-5-3-6-10-22)13-14-30(21-28)20-23-11-7-4-8-12-23/h3-12,15-17H,13-14,18-21H2,1-2H3,(H,29,31) |
| InChIKey | QASUUYUWNUTKFI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |