C11H13N3OS — CID 19705394
3-but-3-enyl-5-hydroxy-4-pyridin-3-yl-2H-1,2,5-thiadiazole (PubChem CID 19705394) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-but-3-enyl-5-hydroxy-4-pyridin-3-yl-2H-1,2,5-thiadiazole.
| Compound Name | 3-but-3-enyl-5-hydroxy-4-pyridin-3-yl-2H-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 19705394 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-but-3-enyl-5-hydroxy-4-pyridin-3-yl-2H-1,2,5-thiadiazole |
| SMILES | C=CCCC1=C(c2cccnc2)N(O)SN1 |
| InChI | InChI=1S/C11H13N3OS/c1-2-3-6-10-11(14(15)16-13-10)9-5-4-7-12-8-9/h2,4-5,7-8,13,15H,1,3,6H2 |
| InChIKey | SZLHNVGNTGIMLS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|