C17H24F2O — CID 19706379
5-[4-(2,3-difluorophenyl)cyclohexyl]pentan-1-ol (PubChem CID 19706379) has the molecular formula C17H24F2O and a molecular weight of 282.37 g/mol. Its IUPAC name is 5-[4-(2,3-difluorophenyl)cyclohexyl]pentan-1-ol.
| Compound Name | 5-[4-(2,3-difluorophenyl)cyclohexyl]pentan-1-ol |
|---|---|
| PubChem CID | 19706379 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 5-[4-(2,3-difluorophenyl)cyclohexyl]pentan-1-ol |
| SMILES | OCCCCCC1CCC(c2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C17H24F2O/c18-16-7-4-6-15(17(16)19)14-10-8-13(9-11-14)5-2-1-3-12-20/h4,6-7,13-14,20H,1-3,5,8-12H2 |
| InChIKey | QOFBMNHTESDWGM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|