C32H32N2O5S — CID 19707450
N-(benzenesulfonyl)-4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethyl]benzamide (PubChem CID 19707450) has the molecular formula C32H32N2O5S and a molecular weight of 556.68 g/mol. Its IUPAC name is N-(benzenesulfonyl)-4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethyl]benzamide.
| Compound Name | N-(benzenesulfonyl)-4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 19707450 |
| Molecular Formula | C32H32N2O5S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | N-(benzenesulfonyl)-4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethyl]benzamide |
| SMILES | COc1ccc(C(Cc2ccncc2)c2ccc(C(=O)NS(=O)(=O)c3ccccc3)cc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C32H32N2O5S/c1-38-30-16-15-26(22-31(30)39-27-7-5-6-8-27)29(21-23-17-19-33-20-18-23)24-11-13-25(14-12-24)32(35)34-40(36,37)28-9-3-2-4-10-28/h2-4,9-20,22,27,29H,5-8,21H2,1H3,(H,34,35) |
| InChIKey | NHVBPIIEWPUQTH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |