C27H31NO3 — CID 54365893
4-[2-(3-cyclopentyloxy-4-methoxyphenyl)-2-[4-(methoxymethyl)phenyl]ethyl]pyridine (PubChem CID 54365893) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-[2-(3-cyclopentyloxy-4-methoxyphenyl)-2-[4-(methoxymethyl)phenyl]ethyl]pyridine.
| Compound Name | 4-[2-(3-cyclopentyloxy-4-methoxyphenyl)-2-[4-(methoxymethyl)phenyl]ethyl]pyridine |
|---|---|
| PubChem CID | 54365893 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 4-[2-(3-cyclopentyloxy-4-methoxyphenyl)-2-[4-(methoxymethyl)phenyl]ethyl]pyridine |
| SMILES | COCc1ccc(C(Cc2ccncc2)c2ccc(OC)c(OC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C27H31NO3/c1-29-19-21-7-9-22(10-8-21)25(17-20-13-15-28-16-14-20)23-11-12-26(30-2)27(18-23)31-24-5-3-4-6-24/h7-16,18,24-25H,3-6,17,19H2,1-2H3 |
| InChIKey | UPTFZDTUGHVEHC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |