C29H32N4O2 — CID 91350902
2-cyano-N-[3-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethyl]phenyl]-N'-methylethanimidamide (PubChem CID 91350902) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-cyano-N-[3-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethyl]phenyl]-N'-methylethanimidamide.
| Compound Name | 2-cyano-N-[3-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethyl]phenyl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 91350902 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-cyano-N-[3-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethyl]phenyl]-N'-methylethanimidamide |
| SMILES | C/N=C(\CC#N)Nc1cccc(C(Cc2ccncc2)c2ccc(OC)c(OC3CCCC3)c2)c1 |
| InChI | InChI=1S/C29H32N4O2/c1-31-29(12-15-30)33-24-7-5-6-22(19-24)26(18-21-13-16-32-17-14-21)23-10-11-27(34-2)28(20-23)35-25-8-3-4-9-25/h5-7,10-11,13-14,16-17,19-20,25-26H,3-4,8-9,12,18H2,1-2H3,(H,31,33) |
| InChIKey | MGNKURDRKFHJID-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|