C26H15Cl6N3O4S2 — CID 19713067
2,3,4,5-tetrachloro-6-[[4-[1-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 19713067) has the molecular formula C26H15Cl6N3O4S2 and a molecular weight of 710.27 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[4-[1-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[4-[1-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 19713067 |
| Molecular Formula | C26H15Cl6N3O4S2 |
| Molecular Weight | 710.27 g/mol |
| Exact Mass | 706.86 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[4-[1-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CC(Sc1ccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)cc1)C(=O)Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C26H15Cl6N3O4S2/c1-10(23(36)35-26-34-16(9-40-26)14-7-2-11(27)8-15(14)28)41-13-5-3-12(4-6-13)33-24(37)17-18(25(38)39)20(30)22(32)21(31)19(17)29/h2-10H,1H3,(H,33,37)(H,38,39)(H,34,35,36) |
| InChIKey | SFBRBOLTAXRFRU-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.27 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|