C29H26N4O5S3 — CID 19715003
ethyl 2-[2-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 19715003) has the molecular formula C29H26N4O5S3 and a molecular weight of 606.75 g/mol. Its IUPAC name is ethyl 2-[2-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19715003 |
| Molecular Formula | C29H26N4O5S3 |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | ethyl 2-[2-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)CSc2ccc(NC(=O)/C(=C/c3cccs3)NC(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C29H26N4O5S3/c1-2-38-26(35)15-21-17-41-29(31-21)33-25(34)18-40-22-12-10-20(11-13-22)30-28(37)24(16-23-9-6-14-39-23)32-27(36)19-7-4-3-5-8-19/h3-14,16-17H,2,15,18H2,1H3,(H,30,37)(H,32,36)(H,31,33,34)/b24-16- |
| InChIKey | VVPFZTLMNRIDHY-JLPGSUDCSA-N |
| XLogP | 5.45 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|