C33H33N5O5S2 — CID 19319828
ethyl 2-[2-[[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 19319828) has the molecular formula C33H33N5O5S2 and a molecular weight of 643.79 g/mol. Its IUPAC name is ethyl 2-[2-[[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19319828 |
| Molecular Formula | C33H33N5O5S2 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | ethyl 2-[2-[[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccc(N(C)C)cc3)NC(=O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C33H33N5O5S2/c1-4-43-30(40)19-25-20-45-33(35-25)37-29(39)21-44-27-12-8-11-24(18-27)34-32(42)28(36-31(41)23-9-6-5-7-10-23)17-22-13-15-26(16-14-22)38(2)3/h5-18,20H,4,19,21H2,1-3H3,(H,34,42)(H,36,41)(H,35,37,39)/b28-17+ |
| InChIKey | GWHPPLUUOBQUQV-OGLMXYFKSA-N |
| XLogP | 5.46 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|