C21H19N5O3S2 — CID 19723965
2-[[5-(1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 19723965) has the molecular formula C21H19N5O3S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 2-[[5-(1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19723965 |
| Molecular Formula | C21H19N5O3S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2-[[5-(1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | CC(C)n1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)nnc1-c1csc2ccccc12 |
| InChI | InChI=1S/C21H19N5O3S2/c1-13(2)25-20(17-11-30-18-6-4-3-5-16(17)18)23-24-21(25)31-12-19(27)22-14-7-9-15(10-8-14)26(28)29/h3-11,13H,12H2,1-2H3,(H,22,27) |
| InChIKey | KVLZMJCIRAFCGQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|