C22H26N4O4S2 — CID 19726460
methyl 2-[[2-[[5-(2-methylfuran-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19726460) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(2-methylfuran-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(2-methylfuran-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19726460 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | methyl 2-[[2-[[5-(2-methylfuran-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2nnc(-c3ccoc3C)n2C(C)C)sc2c1CCCC2 |
| InChI | InChI=1S/C22H26N4O4S2/c1-12(2)26-19(14-9-10-30-13(14)3)24-25-22(26)31-11-17(27)23-20-18(21(28)29-4)15-7-5-6-8-16(15)32-20/h9-10,12H,5-8,11H2,1-4H3,(H,23,27) |
| InChIKey | LTROVXXJBJWDGG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |