C18H15ClFN3O4S — CID 19735478
N-[5-(4-chlorophenyl)-6-(2-hydroxyethoxy)pyrimidin-4-yl]-4-fluorobenzenesulfonamide (PubChem CID 19735478) has the molecular formula C18H15ClFN3O4S and a molecular weight of 423.85 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-6-(2-hydroxyethoxy)pyrimidin-4-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[5-(4-chlorophenyl)-6-(2-hydroxyethoxy)pyrimidin-4-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 19735478 |
| Molecular Formula | C18H15ClFN3O4S |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | N-[5-(4-chlorophenyl)-6-(2-hydroxyethoxy)pyrimidin-4-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncnc(OCCO)c1-c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15ClFN3O4S/c19-13-3-1-12(2-4-13)16-17(21-11-22-18(16)27-10-9-24)23-28(25,26)15-7-5-14(20)6-8-15/h1-8,11,24H,9-10H2,(H,21,22,23) |
| InChIKey | UXZZIWIVKSNGOB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |