C28H31N5O4S — CID 19689480
N-[6-[2-[(5-amino-2-pyridinyl)oxy]ethoxy]-5-(4-methylphenyl)pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide (PubChem CID 19689480) has the molecular formula C28H31N5O4S and a molecular weight of 533.65 g/mol. Its IUPAC name is N-[6-[2-[(5-amino-2-pyridinyl)oxy]ethoxy]-5-(4-methylphenyl)pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[6-[2-[(5-amino-2-pyridinyl)oxy]ethoxy]-5-(4-methylphenyl)pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 19689480 |
| Molecular Formula | C28H31N5O4S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | N-[6-[2-[(5-amino-2-pyridinyl)oxy]ethoxy]-5-(4-methylphenyl)pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide |
| SMILES | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccc(N)cn2)cc1 |
| InChI | InChI=1S/C28H31N5O4S/c1-19-5-7-20(8-6-19)25-26(33-38(34,35)23-12-9-21(10-13-23)28(2,3)4)31-18-32-27(25)37-16-15-36-24-14-11-22(29)17-30-24/h5-14,17-18H,15-16,29H2,1-4H3,(H,31,32,33) |
| InChIKey | JKPAQVWBWSPFQV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|