C31H36N4O5S2 — CID 139913235
N-[6-[2-(benzylsulfonylmethylamino)ethoxy]-5-(4-methylphenyl)pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide (PubChem CID 139913235) has the molecular formula C31H36N4O5S2 and a molecular weight of 608.79 g/mol. Its IUPAC name is N-[6-[2-(benzylsulfonylmethylamino)ethoxy]-5-(4-methylphenyl)pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[6-[2-(benzylsulfonylmethylamino)ethoxy]-5-(4-methylphenyl)pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 139913235 |
| Molecular Formula | C31H36N4O5S2 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | N-[6-[2-(benzylsulfonylmethylamino)ethoxy]-5-(4-methylphenyl)pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide |
| SMILES | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCNCS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H36N4O5S2/c1-23-10-12-25(13-11-23)28-29(35-42(38,39)27-16-14-26(15-17-27)31(2,3)4)33-21-34-30(28)40-19-18-32-22-41(36,37)20-24-8-6-5-7-9-24/h5-17,21,32H,18-20,22H2,1-4H3,(H,33,34,35) |
| InChIKey | KGSXBKIXFKNDNE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|