C31H35N3O4S2 — CID 18931087
4-tert-butyl-N-[5-(4-methylphenyl)-2-methylsulfanyl-6-(2-phenylmethoxyethoxy)pyrimidin-4-yl]benzenesulfonamide (PubChem CID 18931087) has the molecular formula C31H35N3O4S2 and a molecular weight of 577.77 g/mol. Its IUPAC name is 4-tert-butyl-N-[5-(4-methylphenyl)-2-methylsulfanyl-6-(2-phenylmethoxyethoxy)pyrimidin-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[5-(4-methylphenyl)-2-methylsulfanyl-6-(2-phenylmethoxyethoxy)pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18931087 |
| Molecular Formula | C31H35N3O4S2 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 4-tert-butyl-N-[5-(4-methylphenyl)-2-methylsulfanyl-6-(2-phenylmethoxyethoxy)pyrimidin-4-yl]benzenesulfonamide |
| SMILES | CSc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(-c2ccc(C)cc2)c(OCCOCc2ccccc2)n1 |
| InChI | InChI=1S/C31H35N3O4S2/c1-22-11-13-24(14-12-22)27-28(34-40(35,36)26-17-15-25(16-18-26)31(2,3)4)32-30(39-5)33-29(27)38-20-19-37-21-23-9-7-6-8-10-23/h6-18H,19-21H2,1-5H3,(H,32,33,34) |
| InChIKey | GTTQBBDNDSHXNP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|