C28H30N4O4S — CID 173316064
4-tert-butyl-N-[5-(4-methylphenyl)-6-(2-pyridin-2-yloxyethoxy)pyrimidin-4-yl]benzenesulfonamide (PubChem CID 173316064) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is 4-tert-butyl-N-[5-(4-methylphenyl)-6-(2-pyridin-2-yloxyethoxy)pyrimidin-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[5-(4-methylphenyl)-6-(2-pyridin-2-yloxyethoxy)pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 173316064 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-tert-butyl-N-[5-(4-methylphenyl)-6-(2-pyridin-2-yloxyethoxy)pyrimidin-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccccn2)cc1 |
| InChI | InChI=1S/C28H30N4O4S/c1-20-8-10-21(11-9-20)25-26(32-37(33,34)23-14-12-22(13-15-23)28(2,3)4)30-19-31-27(25)36-18-17-35-24-7-5-6-16-29-24/h5-16,19H,17-18H2,1-4H3,(H,30,31,32) |
| InChIKey | JODWRKNEAIMPAW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|