C27H23F3N4O4S — CID 23393995
(E)-N-[5-(4-methylphenyl)-6-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethoxy]pyrimidin-4-yl]-2-phenylethenesulfonamide (PubChem CID 23393995) has the molecular formula C27H23F3N4O4S and a molecular weight of 556.57 g/mol. Its IUPAC name is (E)-N-[5-(4-methylphenyl)-6-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethoxy]pyrimidin-4-yl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[5-(4-methylphenyl)-6-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethoxy]pyrimidin-4-yl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 23393995 |
| Molecular Formula | C27H23F3N4O4S |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | (E)-N-[5-(4-methylphenyl)-6-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethoxy]pyrimidin-4-yl]-2-phenylethenesulfonamide |
| SMILES | Cc1ccc(-c2c(NS(=O)(=O)/C=C/c3ccccc3)ncnc2OCCOc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C27H23F3N4O4S/c1-19-7-9-21(10-8-19)24-25(34-39(35,36)16-13-20-5-3-2-4-6-20)32-18-33-26(24)38-15-14-37-23-12-11-22(17-31-23)27(28,29)30/h2-13,16-18H,14-15H2,1H3,(H,32,33,34)/b16-13+ |
| InChIKey | JDHNPKXLNGFROW-DTQAZKPQSA-N |
| XLogP | 5.74 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|