C28H32N6O5S — CID 18184210
N-[6-(3-aminopropoxy)-5-[4-(2-methoxyphenoxy)pyrimidin-2-yl]pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide (PubChem CID 18184210) has the molecular formula C28H32N6O5S and a molecular weight of 564.67 g/mol. Its IUPAC name is N-[6-(3-aminopropoxy)-5-[4-(2-methoxyphenoxy)pyrimidin-2-yl]pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[6-(3-aminopropoxy)-5-[4-(2-methoxyphenoxy)pyrimidin-2-yl]pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 18184210 |
| Molecular Formula | C28H32N6O5S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | N-[6-(3-aminopropoxy)-5-[4-(2-methoxyphenoxy)pyrimidin-2-yl]pyrimidin-4-yl]-4-tert-butylbenzenesulfonamide |
| SMILES | COc1ccccc1Oc1ccnc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCCN)n1 |
| InChI | InChI=1S/C28H32N6O5S/c1-28(2,3)19-10-12-20(13-11-19)40(35,36)34-26-24(27(32-18-31-26)38-17-7-15-29)25-30-16-14-23(33-25)39-22-9-6-5-8-21(22)37-4/h5-6,8-14,16,18H,7,15,17,29H2,1-4H3,(H,31,32,34) |
| InChIKey | DRJWHDXJBCOUII-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 151.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|