C10H23N2O6P — CID 19738181
[3-(2-diethoxyphosphorylethylamino)-2-hydroxypropyl]carbamic acid (PubChem CID 19738181) has the molecular formula C10H23N2O6P and a molecular weight of 298.28 g/mol. Its IUPAC name is [3-(2-diethoxyphosphorylethylamino)-2-hydroxypropyl]carbamic acid.
| Compound Name | [3-(2-diethoxyphosphorylethylamino)-2-hydroxypropyl]carbamic acid |
|---|---|
| PubChem CID | 19738181 |
| Molecular Formula | C10H23N2O6P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [3-(2-diethoxyphosphorylethylamino)-2-hydroxypropyl]carbamic acid |
| SMILES | CCOP(=O)(CCNCC(O)CNC(=O)O)OCC |
| InChI | InChI=1S/C10H23N2O6P/c1-3-17-19(16,18-4-2)6-5-11-7-9(13)8-12-10(14)15/h9,11-13H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | GEVIHYSFNVOTOW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|