C8H14N2O2S — CID 19738253
3-methyl-1,2-thiazole-5-carboxylate;propan-2-ylazanium (PubChem CID 19738253) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-methyl-1,2-thiazole-5-carboxylate;propan-2-ylazanium.
| Compound Name | 3-methyl-1,2-thiazole-5-carboxylate;propan-2-ylazanium |
|---|---|
| PubChem CID | 19738253 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3-methyl-1,2-thiazole-5-carboxylate;propan-2-ylazanium |
| SMILES | CC(C)[NH3+].Cc1cc(C(=O)[O-])sn1 |
| InChI | InChI=1S/C5H5NO2S.C3H9N/c1-3-2-4(5(7)8)9-6-3;1-3(2)4/h2H,1H3,(H,7,8);3H,4H2,1-2H3 |
| InChIKey | ROAZXMNAYMNLLS-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |