C11H20N2O2S — CID 139604222
3-methyl-1,2-thiazole-5-carboxylate;triethylazanium (PubChem CID 139604222) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-methyl-1,2-thiazole-5-carboxylate;triethylazanium.
| Compound Name | 3-methyl-1,2-thiazole-5-carboxylate;triethylazanium |
|---|---|
| PubChem CID | 139604222 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-methyl-1,2-thiazole-5-carboxylate;triethylazanium |
| SMILES | CC[NH+](CC)CC.Cc1cc(C(=O)[O-])sn1 |
| InChI | InChI=1S/C6H15N.C5H5NO2S/c1-4-7(5-2)6-3;1-3-2-4(5(7)8)9-6-3/h4-6H2,1-3H3;2H,1H3,(H,7,8) |
| InChIKey | GQFVLNZNPZTLKM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 57.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |