C9H13N3O2S — CID 117215834
3-(piperazin-1-ylmethyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 117215834) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-(piperazin-1-ylmethyl)-1,2-thiazole-5-carboxylic acid.
| Compound Name | 3-(piperazin-1-ylmethyl)-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215834 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-(piperazin-1-ylmethyl)-1,2-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(CN2CCNCC2)ns1 |
| InChI | InChI=1S/C9H13N3O2S/c13-9(14)8-5-7(11-15-8)6-12-3-1-10-2-4-12/h5,10H,1-4,6H2,(H,13,14) |
| InChIKey | NHXKUGQXGVPMHS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |