C9H13N3O3 — CID 117192336
5-(piperazin-1-ylmethyl)-1,3-oxazole-2-carboxylic acid (PubChem CID 117192336) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-(piperazin-1-ylmethyl)-1,3-oxazole-2-carboxylic acid.
| Compound Name | 5-(piperazin-1-ylmethyl)-1,3-oxazole-2-carboxylic acid |
|---|---|
| PubChem CID | 117192336 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-(piperazin-1-ylmethyl)-1,3-oxazole-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(CN2CCNCC2)o1 |
| InChI | InChI=1S/C9H13N3O3/c13-9(14)8-11-5-7(15-8)6-12-3-1-10-2-4-12/h5,10H,1-4,6H2,(H,13,14) |
| InChIKey | BOYWFUQQGHRBRL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |