C7H10N2O2S — CID 117215864
3-(ethylaminomethyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 117215864) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-1,2-thiazole-5-carboxylic acid.
| Compound Name | 3-(ethylaminomethyl)-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215864 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(ethylaminomethyl)-1,2-thiazole-5-carboxylic acid |
| SMILES | CCNCc1cc(C(=O)O)sn1 |
| InChI | InChI=1S/C7H10N2O2S/c1-2-8-4-5-3-6(7(10)11)12-9-5/h3,8H,2,4H2,1H3,(H,10,11) |
| InChIKey | XZLNZCPNLOVYPI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |