C9H10N2O3S — CID 117215209
3-(cyclobutylcarbamoyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 117215209) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 3-(cyclobutylcarbamoyl)-1,2-thiazole-5-carboxylic acid.
| Compound Name | 3-(cyclobutylcarbamoyl)-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215209 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 3-(cyclobutylcarbamoyl)-1,2-thiazole-5-carboxylic acid |
| SMILES | O=C(NC1CCC1)c1cc(C(=O)O)sn1 |
| InChI | InChI=1S/C9H10N2O3S/c12-8(10-5-2-1-3-5)6-4-7(9(13)14)15-11-6/h4-5H,1-3H2,(H,10,12)(H,13,14) |
| InChIKey | GBZMIWQLNMASLD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |