C7H8N2O3S — CID 117215213
3-(dimethylcarbamoyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 117215213) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is 3-(dimethylcarbamoyl)-1,2-thiazole-5-carboxylic acid.
| Compound Name | 3-(dimethylcarbamoyl)-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215213 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 3-(dimethylcarbamoyl)-1,2-thiazole-5-carboxylic acid |
| SMILES | CN(C)C(=O)c1cc(C(=O)O)sn1 |
| InChI | InChI=1S/C7H8N2O3S/c1-9(2)6(10)4-3-5(7(11)12)13-8-4/h3H,1-2H3,(H,11,12) |
| InChIKey | YLTPRQLDIXUQNT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |