C10H12N2O3S — CID 117215215
3-(piperidine-1-carbonyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 117215215) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 3-(piperidine-1-carbonyl)-1,2-thiazole-5-carboxylic acid.
| Compound Name | 3-(piperidine-1-carbonyl)-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215215 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-(piperidine-1-carbonyl)-1,2-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)N2CCCCC2)ns1 |
| InChI | InChI=1S/C10H12N2O3S/c13-9(12-4-2-1-3-5-12)7-6-8(10(14)15)16-11-7/h6H,1-5H2,(H,14,15) |
| InChIKey | XFDZDUMEHUBBSQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |