C10H14N2O2S — CID 117215828
3-[(cyclopentylamino)methyl]-1,2-thiazole-5-carboxylic acid (PubChem CID 117215828) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-[(cyclopentylamino)methyl]-1,2-thiazole-5-carboxylic acid.
| Compound Name | 3-[(cyclopentylamino)methyl]-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215828 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-[(cyclopentylamino)methyl]-1,2-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(CNC2CCCC2)ns1 |
| InChI | InChI=1S/C10H14N2O2S/c13-10(14)9-5-8(12-15-9)6-11-7-3-1-2-4-7/h5,7,11H,1-4,6H2,(H,13,14) |
| InChIKey | ULZUSAGEFVABDK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |