C32H44O4 — CID 19742388
[2-cyclohexyl-2-[4-(3-methylbutyl)benzoyl]oxyethyl] 4-(3-methylbutyl)benzoate (PubChem CID 19742388) has the molecular formula C32H44O4 and a molecular weight of 492.70 g/mol. Its IUPAC name is [2-cyclohexyl-2-[4-(3-methylbutyl)benzoyl]oxyethyl] 4-(3-methylbutyl)benzoate.
| Compound Name | [2-cyclohexyl-2-[4-(3-methylbutyl)benzoyl]oxyethyl] 4-(3-methylbutyl)benzoate |
|---|---|
| PubChem CID | 19742388 |
| Molecular Formula | C32H44O4 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | [2-cyclohexyl-2-[4-(3-methylbutyl)benzoyl]oxyethyl] 4-(3-methylbutyl)benzoate |
| SMILES | CC(C)CCc1ccc(C(=O)OCC(OC(=O)c2ccc(CCC(C)C)cc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H44O4/c1-23(2)10-12-25-14-18-28(19-15-25)31(33)35-22-30(27-8-6-5-7-9-27)36-32(34)29-20-16-26(17-21-29)13-11-24(3)4/h14-21,23-24,27,30H,5-13,22H2,1-4H3 |
| InChIKey | JFGNAIDIHLWBCU-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |