C9H7F9O2 — CID 19744947
3,4,4,5,5,6,7,8,8-nonafluoro-2-methylideneoctanoic acid (PubChem CID 19744947) has the molecular formula C9H7F9O2 and a molecular weight of 318.14 g/mol. Its IUPAC name is 3,4,4,5,5,6,7,8,8-nonafluoro-2-methylideneoctanoic acid.
| Compound Name | 3,4,4,5,5,6,7,8,8-nonafluoro-2-methylideneoctanoic acid |
|---|---|
| PubChem CID | 19744947 |
| Molecular Formula | C9H7F9O2 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 3,4,4,5,5,6,7,8,8-nonafluoro-2-methylideneoctanoic acid |
| SMILES | C=C(C(=O)O)C(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C9H7F9O2/c1-2(7(19)20)4(11)8(15,16)9(17,18)5(12)3(10)6(13)14/h3-6H,1H2,(H,19,20) |
| InChIKey | GKBAWSSAJIXEMH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|