C16H15Cl2FN2O2 — CID 19745697
[2-chloro-5-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-4-fluorophenyl] propanoate (PubChem CID 19745697) has the molecular formula C16H15Cl2FN2O2 and a molecular weight of 357.21 g/mol. Its IUPAC name is [2-chloro-5-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-4-fluorophenyl] propanoate.
| Compound Name | [2-chloro-5-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-4-fluorophenyl] propanoate |
|---|---|
| PubChem CID | 19745697 |
| Molecular Formula | C16H15Cl2FN2O2 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | [2-chloro-5-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-4-fluorophenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(-n2nc3c(c2Cl)CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C16H15Cl2FN2O2/c1-2-15(22)23-14-8-13(11(19)7-10(14)17)21-16(18)9-5-3-4-6-12(9)20-21/h7-8H,2-6H2,1H3 |
| InChIKey | WDVLYDHLQNDSBX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|