C27H26ClNO4 — CID 19746259
(E)-3-[3-chloro-5-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-2-phenylmethoxyphenyl]prop-2-enoic acid (PubChem CID 19746259) has the molecular formula C27H26ClNO4 and a molecular weight of 463.96 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-2-phenylmethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-5-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-2-phenylmethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 19746259 |
| Molecular Formula | C27H26ClNO4 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (E)-3-[3-chloro-5-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-2-phenylmethoxyphenyl]prop-2-enoic acid |
| SMILES | CN(CCc1ccccc1)C(=O)Cc1cc(Cl)c(OCc2ccccc2)c(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C27H26ClNO4/c1-29(15-14-20-8-4-2-5-9-20)25(30)18-22-16-23(12-13-26(31)32)27(24(28)17-22)33-19-21-10-6-3-7-11-21/h2-13,16-17H,14-15,18-19H2,1H3,(H,31,32)/b13-12+ |
| InChIKey | XEMMPYMKENDJKL-OUKQBFOZSA-N |
| XLogP | 5.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|