C17H9Cl2F3N2O2 — CID 19746784
2,3-bis(4-chlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole (PubChem CID 19746784) has the molecular formula C17H9Cl2F3N2O2 and a molecular weight of 401.17 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole.
| Compound Name | 2,3-bis(4-chlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole |
|---|---|
| PubChem CID | 19746784 |
| Molecular Formula | C17H9Cl2F3N2O2 |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole |
| SMILES | O=[N+]([O-])c1c(C(F)(F)F)[nH]c(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H9Cl2F3N2O2/c18-11-5-1-9(2-6-11)13-14(10-3-7-12(19)8-4-10)23-16(17(20,21)22)15(13)24(25)26/h1-8,23H |
| InChIKey | GMTKJPKTYKNAQW-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|