C17H8Cl3F3N2O2 — CID 19746747
2-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-3-nitro-5-(trifluoromethyl)-1H-pyrrole (PubChem CID 19746747) has the molecular formula C17H8Cl3F3N2O2 and a molecular weight of 435.62 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-3-nitro-5-(trifluoromethyl)-1H-pyrrole.
| Compound Name | 2-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-3-nitro-5-(trifluoromethyl)-1H-pyrrole |
|---|---|
| PubChem CID | 19746747 |
| Molecular Formula | C17H8Cl3F3N2O2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-3-nitro-5-(trifluoromethyl)-1H-pyrrole |
| SMILES | O=[N+]([O-])c1c(-c2ccc(Cl)cc2)[nH]c(C(F)(F)F)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H8Cl3F3N2O2/c18-9-3-1-8(2-4-9)14-15(25(26)27)13(16(24-14)17(21,22)23)11-6-5-10(19)7-12(11)20/h1-7,24H |
| InChIKey | OHUSISPYCQSHSC-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|