C17H14Cl2N4O5 — CID 19747533
5,7-dichloro-4-[(3-nitrophenyl)carbamoylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 19747533) has the molecular formula C17H14Cl2N4O5 and a molecular weight of 425.23 g/mol. Its IUPAC name is 5,7-dichloro-4-[(3-nitrophenyl)carbamoylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | 5,7-dichloro-4-[(3-nitrophenyl)carbamoylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 19747533 |
| Molecular Formula | C17H14Cl2N4O5 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 5,7-dichloro-4-[(3-nitrophenyl)carbamoylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)NC1CC(C(=O)O)Nc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C17H14Cl2N4O5/c18-8-4-11(19)15-12(5-8)21-14(16(24)25)7-13(15)22-17(26)20-9-2-1-3-10(6-9)23(27)28/h1-6,13-14,21H,7H2,(H,24,25)(H2,20,22,26) |
| InChIKey | QCBYWVGANQEHBX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|