C18H24N2O4S — CID 19748145
3-methoxy-12-methylsulfonyl-6,8a,9,10,11,12a,13,13a-octahydro-5H-isoquinolino[2,1-g][1,6]naphthyridin-8-one (PubChem CID 19748145) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-methoxy-12-methylsulfonyl-6,8a,9,10,11,12a,13,13a-octahydro-5H-isoquinolino[2,1-g][1,6]naphthyridin-8-one.
| Compound Name | 3-methoxy-12-methylsulfonyl-6,8a,9,10,11,12a,13,13a-octahydro-5H-isoquinolino[2,1-g][1,6]naphthyridin-8-one |
|---|---|
| PubChem CID | 19748145 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-methoxy-12-methylsulfonyl-6,8a,9,10,11,12a,13,13a-octahydro-5H-isoquinolino[2,1-g][1,6]naphthyridin-8-one |
| SMILES | COc1ccc2c(c1)CCN1C(=O)C3CCCN(S(C)(=O)=O)C3CC21 |
| InChI | InChI=1S/C18H24N2O4S/c1-24-13-5-6-14-12(10-13)7-9-19-16(14)11-17-15(18(19)21)4-3-8-20(17)25(2,22)23/h5-6,10,15-17H,3-4,7-9,11H2,1-2H3 |
| InChIKey | AEHPRDUDORDFJI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |