About (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne
(5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne (PubChem CID 19748542) has the molecular formula C9H11Cl
and a molecular weight of 154.64 g/mol. Its IUPAC name is (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne.
Molecular Properties
| Compound Name | (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne |
| PubChem CID | 19748542 |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.64 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne |
| SMILES | C=C(C)C#C/C=C(\C)CCl |
| InChI | InChI=1S/C9H11Cl/c1-8(2)5-4-6-9(3)7-10/h6H,1,7H2,2-3H3/b9-6+ |
| InChIKey | MSOSVWQUFGKGCV-RMKNXTFCSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne?
The IUPAC name of (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne (CID 19748542) is (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne.
What is the SMILES notation for (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne?
The canonical SMILES for (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne is C=C(C)C#C/C=C(\C)CCl.
What is the InChIKey of (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne?
The InChIKey is MSOSVWQUFGKGCV-RMKNXTFCSA-N. The full InChI is InChI=1S/C9H11Cl/c1-8(2)5-4-6-9(3)7-10/h6H,1,7H2,2-3H3/b9-6+.
What are the key properties of (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne?
(5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne has a molecular weight of 154.64 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne is sourced from PubChem (CID 19748542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).