C9H11Cl — CID 19748542
(5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne (PubChem CID 19748542) has the molecular formula C9H11Cl and a molecular weight of 154.64 g/mol. Its IUPAC name is (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne.
| Compound Name | (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne |
|---|---|
| PubChem CID | 19748542 |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.64 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | (5E)-7-chloro-2,6-dimethylhepta-1,5-dien-3-yne |
| SMILES | C=C(C)C#C/C=C(\C)CCl |
| InChI | InChI=1S/C9H11Cl/c1-8(2)5-4-6-9(3)7-10/h6H,1,7H2,2-3H3/b9-6+ |
| InChIKey | MSOSVWQUFGKGCV-RMKNXTFCSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|