C23H27N3O3S — CID 19749544
N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-2-(3,4-dihydro-1,2-benzodioxin-5-yloxy)ethanamine (PubChem CID 19749544) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-2-(3,4-dihydro-1,2-benzodioxin-5-yloxy)ethanamine.
| Compound Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-2-(3,4-dihydro-1,2-benzodioxin-5-yloxy)ethanamine |
|---|---|
| PubChem CID | 19749544 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-2-(3,4-dihydro-1,2-benzodioxin-5-yloxy)ethanamine |
| SMILES | c1cc(OCCNCC2CCN(c3nc4ccccc4s3)CC2)c2c(c1)OOCC2 |
| InChI | InChI=1S/C23H27N3O3S/c1-2-7-22-19(4-1)25-23(30-22)26-12-8-17(9-13-26)16-24-11-15-27-20-5-3-6-21-18(20)10-14-28-29-21/h1-7,17,24H,8-16H2 |
| InChIKey | HFHGNMFCLPRKSB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|