C25H22F7N3O2 — CID 19749828
2-[4-[[2-cyclohexyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid (PubChem CID 19749828) has the molecular formula C25H22F7N3O2 and a molecular weight of 529.46 g/mol. Its IUPAC name is 2-[4-[[2-cyclohexyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-cyclohexyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19749828 |
| Molecular Formula | C25H22F7N3O2 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 2-[4-[[2-cyclohexyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(Cc2nc(C(F)(F)C(F)(F)C(F)(F)F)nn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H22F7N3O2/c26-23(27,24(28,29)25(30,31)32)22-33-20(35(34-22)17-6-2-1-3-7-17)14-15-10-12-16(13-11-15)18-8-4-5-9-19(18)21(36)37/h4-5,8-13,17H,1-3,6-7,14H2,(H,36,37) |
| InChIKey | NETXBIVQSXKHTM-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|