C29H37N3O2 — CID 19750490
2-[4-[[5-(cyclohexylmethyl)-2-hexyl-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid (PubChem CID 19750490) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is 2-[4-[[5-(cyclohexylmethyl)-2-hexyl-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-(cyclohexylmethyl)-2-hexyl-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19750490 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 2-[4-[[5-(cyclohexylmethyl)-2-hexyl-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCCCn1nc(CC2CCCCC2)nc1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H37N3O2/c1-2-3-4-10-19-32-28(30-27(31-32)20-22-11-6-5-7-12-22)21-23-15-17-24(18-16-23)25-13-8-9-14-26(25)29(33)34/h8-9,13-18,22H,2-7,10-12,19-21H2,1H3,(H,33,34) |
| InChIKey | FIBHZLPMOUKWOQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|