C28H33N3O2 — CID 19750683
2-[4-[[2-[(E)-but-2-enyl]-5-(2-cyclohexylethyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid (PubChem CID 19750683) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-[4-[[2-[(E)-but-2-enyl]-5-(2-cyclohexylethyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-[(E)-but-2-enyl]-5-(2-cyclohexylethyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19750683 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2-[4-[[2-[(E)-but-2-enyl]-5-(2-cyclohexylethyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
| SMILES | C/C=C/Cn1nc(CCC2CCCCC2)nc1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C28H33N3O2/c1-2-3-19-31-27(29-26(30-31)18-15-21-9-5-4-6-10-21)20-22-13-16-23(17-14-22)24-11-7-8-12-25(24)28(32)33/h2-3,7-8,11-14,16-17,21H,4-6,9-10,15,18-20H2,1H3,(H,32,33)/b3-2+ |
| InChIKey | CABODKSLQUGGAU-NSCUHMNNSA-N |
| XLogP | 6.32 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|