C28H31N3O3 — CID 19750133
2-[4-[[2-[(E)-but-2-enyl]-5-(2-cyclohexylacetyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid (PubChem CID 19750133) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[4-[[2-[(E)-but-2-enyl]-5-(2-cyclohexylacetyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-[(E)-but-2-enyl]-5-(2-cyclohexylacetyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19750133 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 2-[4-[[2-[(E)-but-2-enyl]-5-(2-cyclohexylacetyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
| SMILES | C/C=C/Cn1nc(C(=O)CC2CCCCC2)nc1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C28H31N3O3/c1-2-3-17-31-26(29-27(30-31)25(32)18-20-9-5-4-6-10-20)19-21-13-15-22(16-14-21)23-11-7-8-12-24(23)28(33)34/h2-3,7-8,11-16,20H,4-6,9-10,17-19H2,1H3,(H,33,34)/b3-2+ |
| InChIKey | PHQDEKYGOBBMCA-NSCUHMNNSA-N |
| XLogP | 5.96 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|