About 2-butyl-1-nitroindole
2-butyl-1-nitroindole (PubChem CID 19754323) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-butyl-1-nitroindole.
Molecular Properties
| Compound Name | 2-butyl-1-nitroindole |
| PubChem CID | 19754323 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-butyl-1-nitroindole |
| SMILES | CCCCc1cc2ccccc2n1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O2/c1-2-3-7-11-9-10-6-4-5-8-12(10)13(11)14(15)16/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | DIRQCFCSQPVWKH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1-nitroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-nitroindole?
The IUPAC name of 2-butyl-1-nitroindole (CID 19754323) is 2-butyl-1-nitroindole.
What is the SMILES notation for 2-butyl-1-nitroindole?
The canonical SMILES for 2-butyl-1-nitroindole is CCCCc1cc2ccccc2n1[N+](=O)[O-].
What is the InChIKey of 2-butyl-1-nitroindole?
The InChIKey is DIRQCFCSQPVWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-2-3-7-11-9-10-6-4-5-8-12(10)13(11)14(15)16/h4-6,8-9H,2-3,7H2,1H3.
What are the key properties of 2-butyl-1-nitroindole?
2-butyl-1-nitroindole has a molecular weight of 218.26 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-nitroindole is sourced from PubChem (CID 19754323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).