C19H21F2N3S — CID 19754686
N-[2-(2-bicyclo[2.2.1]heptanyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carbothioamide (PubChem CID 19754686) has the molecular formula C19H21F2N3S and a molecular weight of 361.46 g/mol. Its IUPAC name is N-[2-(2-bicyclo[2.2.1]heptanyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carbothioamide.
| Compound Name | N-[2-(2-bicyclo[2.2.1]heptanyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 19754686 |
| Molecular Formula | C19H21F2N3S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[2-(2-bicyclo[2.2.1]heptanyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carbothioamide |
| SMILES | Cn1cc(C(=S)Nc2ccccc2C2CC3CCC2C3)c(C(F)F)n1 |
| InChI | InChI=1S/C19H21F2N3S/c1-24-10-15(17(23-24)18(20)21)19(25)22-16-5-3-2-4-13(16)14-9-11-6-7-12(14)8-11/h2-5,10-12,14,18H,6-9H2,1H3,(H,22,25) |
| InChIKey | VYYUDVYKOHJJAC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|