C25H27F2N5 — CID 67411586
N-anilino-N'-[2-(2-bicyclo[2.2.1]heptanyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboximidamide (PubChem CID 67411586) has the molecular formula C25H27F2N5 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-anilino-N'-[2-(2-bicyclo[2.2.1]heptanyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboximidamide.
| Compound Name | N-anilino-N'-[2-(2-bicyclo[2.2.1]heptanyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 67411586 |
| Molecular Formula | C25H27F2N5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-anilino-N'-[2-(2-bicyclo[2.2.1]heptanyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboximidamide |
| SMILES | Cn1cc(/C(=N/c2ccccc2C2CC3CCC2C3)NNc2ccccc2)c(C(F)F)n1 |
| InChI | InChI=1S/C25H27F2N5/c1-32-15-21(23(31-32)24(26)27)25(30-29-18-7-3-2-4-8-18)28-22-10-6-5-9-19(22)20-14-16-11-12-17(20)13-16/h2-10,15-17,20,24,29H,11-14H2,1H3,(H,28,30) |
| InChIKey | KKKPFHLXHHCPPR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|